C28H37F5N6O3 — CID 177041660
12-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-13-fluoro-8-methyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one;ethane;oxane (PubChem CID 177041660) has the molecular formula C28H37F5N6O3 and a molecular weight of 600.63 g/mol. Its IUPAC name is 12-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-13-fluoro-8-methyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one;ethane;oxane.
| Compound Name | 12-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-13-fluoro-8-methyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one;ethane;oxane |
|---|---|
| PubChem CID | 177041660 |
| Molecular Formula | C28H37F5N6O3 |
| Molecular Weight | 600.63 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | 12-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-13-fluoro-8-methyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one;ethane;oxane |
| SMILES | C1CCOCC1.CC.Cc1c(F)c(N)cc(-c2nc3c4c(nc(=O)[nH]c4c2F)NCCNCCC(C)O3)c1C(F)(F)F |
| InChI | InChI=1S/C21H21F5N6O2.C5H10O.C2H6/c1-8-3-4-28-5-6-29-18-12-17(31-20(33)32-18)15(23)16(30-19(12)34-8)10-7-11(27)14(22)9(2)13(10)21(24,25)26;1-2-4-6-5-3-1;1-2/h7-8,28H,3-6,27H2,1-2H3,(H2,29,31,32,33);1-5H2;1-2H3 |
| InChIKey | AWTVQXQOLRUFQI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.63 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|