C31H32F4N6O2 — CID 73295719
1-[4-[3-amino-1-[3-(4-methylpiperazin-1-yl)propoxy]isoquinolin-5-yl]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea (PubChem CID 73295719) has the molecular formula C31H32F4N6O2 and a molecular weight of 596.63 g/mol. Its IUPAC name is 1-[4-[3-amino-1-[3-(4-methylpiperazin-1-yl)propoxy]isoquinolin-5-yl]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[3-amino-1-[3-(4-methylpiperazin-1-yl)propoxy]isoquinolin-5-yl]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 73295719 |
| Molecular Formula | C31H32F4N6O2 |
| Molecular Weight | 596.63 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | 1-[4-[3-amino-1-[3-(4-methylpiperazin-1-yl)propoxy]isoquinolin-5-yl]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea |
| SMILES | CN1CCN(CCCOc2nc(N)cc3c(-c4ccc(NC(=O)Nc5cc(C(F)(F)F)ccc5F)cc4)cccc23)CC1 |
| InChI | InChI=1S/C31H32F4N6O2/c1-40-13-15-41(16-14-40)12-3-17-43-29-24-5-2-4-23(25(24)19-28(36)39-29)20-6-9-22(10-7-20)37-30(42)38-27-18-21(31(33,34)35)8-11-26(27)32/h2,4-11,18-19H,3,12-17H2,1H3,(H2,36,39)(H2,37,38,42) |
| InChIKey | SQRSKHBBBSWOBQ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.63 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|