C16H14F6N2 — CID 177044147
N-(4,4,4-trifluorobutyl)-6-[4-(trifluoromethyl)phenyl]pyridin-3-amine (PubChem CID 177044147) has the molecular formula C16H14F6N2 and a molecular weight of 348.29 g/mol. Its IUPAC name is N-(4,4,4-trifluorobutyl)-6-[4-(trifluoromethyl)phenyl]pyridin-3-amine.
| Compound Name | N-(4,4,4-trifluorobutyl)-6-[4-(trifluoromethyl)phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 177044147 |
| Molecular Formula | C16H14F6N2 |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-(4,4,4-trifluorobutyl)-6-[4-(trifluoromethyl)phenyl]pyridin-3-amine |
| SMILES | FC(F)(F)CCCNc1ccc(-c2ccc(C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C16H14F6N2/c17-15(18,19)8-1-9-23-13-6-7-14(24-10-13)11-2-4-12(5-3-11)16(20,21)22/h2-7,10,23H,1,8-9H2 |
| InChIKey | BVSXHZXVINYHFH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|