C21H24N6O4 — CID 177044252
5-[[1-(4-aminobutyl)imidazol-4-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 177044252) has the molecular formula C21H24N6O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is 5-[[1-(4-aminobutyl)imidazol-4-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[1-(4-aminobutyl)imidazol-4-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 177044252 |
| Molecular Formula | C21H24N6O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 5-[[1-(4-aminobutyl)imidazol-4-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | NCCCCn1cnc(CNc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)c1 |
| InChI | InChI=1S/C21H24N6O4/c22-7-1-2-8-26-11-14(24-12-26)10-23-13-3-4-15-16(9-13)21(31)27(20(15)30)17-5-6-18(28)25-19(17)29/h3-4,9,11-12,17,23H,1-2,5-8,10,22H2,(H,25,28,29) |
| InChIKey | NIZMIQKKBZGSBK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 139.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|