C19H26N6O2 — CID 177044599
ethane;N-(2',5',8'-trimethylspiro[oxetane-3,4'-triazolo[4,5-c][1,7]naphthyridine]-6'-yl)cyclopropanecarboxamide (PubChem CID 177044599) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is ethane;N-(2',5',8'-trimethylspiro[oxetane-3,4'-triazolo[4,5-c][1,7]naphthyridine]-6'-yl)cyclopropanecarboxamide.
| Compound Name | ethane;N-(2',5',8'-trimethylspiro[oxetane-3,4'-triazolo[4,5-c][1,7]naphthyridine]-6'-yl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 177044599 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | ethane;N-(2',5',8'-trimethylspiro[oxetane-3,4'-triazolo[4,5-c][1,7]naphthyridine]-6'-yl)cyclopropanecarboxamide |
| SMILES | CC.Cc1cc2c(c(NC(=O)C3CC3)n1)N(C)C1(COC1)c1nn(C)nc1-2 |
| InChI | InChI=1S/C17H20N6O2.C2H6/c1-9-6-11-12-14(21-23(3)20-12)17(7-25-8-17)22(2)13(11)15(18-9)19-16(24)10-4-5-10;1-2/h6,10H,4-5,7-8H2,1-3H3,(H,18,19,24);1-2H3 |
| InChIKey | PWNOKMCJCKOCIL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |