About ethane;4-ethyl-2-nitrosophenol
ethane;4-ethyl-2-nitrosophenol (PubChem CID 177045182) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is ethane;4-ethyl-2-nitrosophenol.
Molecular Properties
| Compound Name | ethane;4-ethyl-2-nitrosophenol |
| PubChem CID | 177045182 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | ethane;4-ethyl-2-nitrosophenol |
| SMILES | CC.CCc1ccc(O)c(N=O)c1 |
| InChI | InChI=1S/C8H9NO2.C2H6/c1-2-6-3-4-8(10)7(5-6)9-11;1-2/h3-5,10H,2H2,1H3;1-2H3 |
| InChIKey | AMDJDRAJHGSSQC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-ethyl-2-nitrosophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethyl-2-nitrosophenol?
The IUPAC name of ethane;4-ethyl-2-nitrosophenol (CID 177045182) is ethane;4-ethyl-2-nitrosophenol.
What is the SMILES notation for ethane;4-ethyl-2-nitrosophenol?
The canonical SMILES for ethane;4-ethyl-2-nitrosophenol is CC.CCc1ccc(O)c(N=O)c1.
What is the InChIKey of ethane;4-ethyl-2-nitrosophenol?
The InChIKey is AMDJDRAJHGSSQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C2H6/c1-2-6-3-4-8(10)7(5-6)9-11;1-2/h3-5,10H,2H2,1H3;1-2H3.
What are the key properties of ethane;4-ethyl-2-nitrosophenol?
ethane;4-ethyl-2-nitrosophenol has a molecular weight of 181.23 g/mol, XLogP of 3.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethyl-2-nitrosophenol is sourced from PubChem (CID 177045182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).