C9H12N2 — CID 177046969
N-[5-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-yl]methanimine (PubChem CID 177046969) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is N-[5-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-yl]methanimine.
| Compound Name | N-[5-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-yl]methanimine |
|---|---|
| PubChem CID | 177046969 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | N-[5-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-yl]methanimine |
| SMILES | C=NC1=NCCC=C1/C=C\C |
| InChI | InChI=1S/C9H12N2/c1-3-5-8-6-4-7-11-9(8)10-2/h3,5-6H,2,4,7H2,1H3/b5-3- |
| InChIKey | COKJIBPRVSHQOY-HYXAFXHYSA-N |
| XLogP | 1.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|