C22H26N6O2 — CID 177051212
5-cyclopropyl-2-methyl-1,2,4-triazole-3-carboxamide;2-(2-cyclopropyl-4-pyridinyl)-4,5,6,7-tetrahydro-1,3-benzoxazole (PubChem CID 177051212) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 5-cyclopropyl-2-methyl-1,2,4-triazole-3-carboxamide;2-(2-cyclopropyl-4-pyridinyl)-4,5,6,7-tetrahydro-1,3-benzoxazole.
| Compound Name | 5-cyclopropyl-2-methyl-1,2,4-triazole-3-carboxamide;2-(2-cyclopropyl-4-pyridinyl)-4,5,6,7-tetrahydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 177051212 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 5-cyclopropyl-2-methyl-1,2,4-triazole-3-carboxamide;2-(2-cyclopropyl-4-pyridinyl)-4,5,6,7-tetrahydro-1,3-benzoxazole |
| SMILES | Cn1nc(C2CC2)nc1C(N)=O.c1cc(-c2nc3c(o2)CCCC3)cc(C2CC2)n1 |
| InChI | InChI=1S/C15H16N2O.C7H10N4O/c1-2-4-14-12(3-1)17-15(18-14)11-7-8-16-13(9-11)10-5-6-10;1-11-7(5(8)12)9-6(10-11)4-2-3-4/h7-10H,1-6H2;4H,2-3H2,1H3,(H2,8,12) |
| InChIKey | VMFVHUKNHMZJRE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 112.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |