C19H17F3N6O2 — CID 177051390
2-methoxy-N-[(8S)-2-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]pyridine-4-carboxamide (PubChem CID 177051390) has the molecular formula C19H17F3N6O2 and a molecular weight of 418.38 g/mol. Its IUPAC name is 2-methoxy-N-[(8S)-2-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]pyridine-4-carboxamide.
| Compound Name | 2-methoxy-N-[(8S)-2-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 177051390 |
| Molecular Formula | C19H17F3N6O2 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-methoxy-N-[(8S)-2-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]pyridine-4-carboxamide |
| SMILES | COc1cc(C(=O)N[C@H]2CCCn3nc(-c4ccnc(C(F)(F)F)c4)nc32)ccn1 |
| InChI | InChI=1S/C19H17F3N6O2/c1-30-15-10-12(5-7-24-15)18(29)25-13-3-2-8-28-17(13)26-16(27-28)11-4-6-23-14(9-11)19(20,21)22/h4-7,9-10,13H,2-3,8H2,1H3,(H,25,29)/t13-/m0/s1 |
| InChIKey | JUSFYNCITQWLFT-ZDUSSCGKSA-N |
| XLogP | 3.03 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |