C12H9F3N6 — CID 177051812
(4S)-4-azido-2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole (PubChem CID 177051812) has the molecular formula C12H9F3N6 and a molecular weight of 294.24 g/mol. Its IUPAC name is (4S)-4-azido-2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole.
| Compound Name | (4S)-4-azido-2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole |
|---|---|
| PubChem CID | 177051812 |
| Molecular Formula | C12H9F3N6 |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (4S)-4-azido-2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole |
| SMILES | [N-]=[N+]=N[C@H]1CCn2nc(-c3ccnc(C(F)(F)F)c3)cc21 |
| InChI | InChI=1S/C12H9F3N6/c13-12(14,15)11-5-7(1-3-17-11)9-6-10-8(18-20-16)2-4-21(10)19-9/h1,3,5-6,8H,2,4H2/t8-/m0/s1 |
| InChIKey | JTVKKADPHWSOSZ-QMMMGPOBSA-N |
| XLogP | 3.72 |
| TPSA | 79.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|