About ethane;N-ethyl-N-methylbutan-2-amine;vanadium
ethane;N-ethyl-N-methylbutan-2-amine;vanadium (PubChem CID 177053433) has the molecular formula C9H22NV-
and a molecular weight of 195.23 g/mol. Its IUPAC name is ethane;N-ethyl-N-methylbutan-2-amine;vanadium.
Molecular Properties
| Compound Name | ethane;N-ethyl-N-methylbutan-2-amine;vanadium |
| PubChem CID | 177053433 |
| Molecular Formula | C9H22NV- |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | ethane;N-ethyl-N-methylbutan-2-amine;vanadium |
| SMILES | CC.[CH2-]CN(C)C(C)CC.[V] |
| InChI | InChI=1S/C7H16N.C2H6.V/c1-5-7(3)8(4)6-2;1-2;/h7H,2,5-6H2,1,3-4H3;1-2H3;/q-1;; |
| InChIKey | KTIACRBFOZDRQR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-ethyl-N-methylbutan-2-amine;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-N-methylbutan-2-amine;vanadium?
The IUPAC name of ethane;N-ethyl-N-methylbutan-2-amine;vanadium (CID 177053433) is ethane;N-ethyl-N-methylbutan-2-amine;vanadium.
What is the SMILES notation for ethane;N-ethyl-N-methylbutan-2-amine;vanadium?
The canonical SMILES for ethane;N-ethyl-N-methylbutan-2-amine;vanadium is CC.[CH2-]CN(C)C(C)CC.[V].
What is the InChIKey of ethane;N-ethyl-N-methylbutan-2-amine;vanadium?
The InChIKey is KTIACRBFOZDRQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N.C2H6.V/c1-5-7(3)8(4)6-2;1-2;/h7H,2,5-6H2,1,3-4H3;1-2H3;/q-1;;.
What are the key properties of ethane;N-ethyl-N-methylbutan-2-amine;vanadium?
ethane;N-ethyl-N-methylbutan-2-amine;vanadium has a molecular weight of 195.23 g/mol, XLogP of 2.57, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-N-methylbutan-2-amine;vanadium is sourced from PubChem (CID 177053433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).