C19H35O9P — CID 177053480
methyl 2-[bis(1-propan-2-yloxyethenoxymethoxy)phosphorylmethyl]pentanoate (PubChem CID 177053480) has the molecular formula C19H35O9P and a molecular weight of 438.45 g/mol. Its IUPAC name is methyl 2-[bis(1-propan-2-yloxyethenoxymethoxy)phosphorylmethyl]pentanoate.
| Compound Name | methyl 2-[bis(1-propan-2-yloxyethenoxymethoxy)phosphorylmethyl]pentanoate |
|---|---|
| PubChem CID | 177053480 |
| Molecular Formula | C19H35O9P |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | methyl 2-[bis(1-propan-2-yloxyethenoxymethoxy)phosphorylmethyl]pentanoate |
| SMILES | C=C(OCOP(=O)(CC(CCC)C(=O)OC)OCOC(=C)OC(C)C)OC(C)C |
| InChI | InChI=1S/C19H35O9P/c1-9-10-18(19(20)22-8)11-29(21,25-12-23-16(6)27-14(2)3)26-13-24-17(7)28-15(4)5/h14-15,18H,6-7,9-13H2,1-5,8H3 |
| InChIKey | ZJOHLMAKKYVRCT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|