C18H35NO4Si — CID 177053901
tert-butyl (2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-(2-oxoethyl)pyrrolidine-1-carboxylate (PubChem CID 177053901) has the molecular formula C18H35NO4Si and a molecular weight of 357.57 g/mol. Its IUPAC name is tert-butyl (2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-(2-oxoethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-(2-oxoethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177053901 |
| Molecular Formula | C18H35NO4Si |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | tert-butyl (2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-(2-oxoethyl)pyrrolidine-1-carboxylate |
| SMILES | C[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H](CC=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H35NO4Si/c1-13-15(23-24(8,9)18(5,6)7)12-14(10-11-20)19(13)16(21)22-17(2,3)4/h11,13-15H,10,12H2,1-9H3/t13-,14-,15-/m1/s1 |
| InChIKey | XTBKFEGEKTXTNG-RBSFLKMASA-N |
| XLogP | 4.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|