C18H35NO4Si — CID 10959261
tert-butyl (2S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxoethyl)piperidine-1-carboxylate (PubChem CID 10959261) has the molecular formula C18H35NO4Si and a molecular weight of 357.57 g/mol. Its IUPAC name is tert-butyl (2S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxoethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxoethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10959261 |
| Molecular Formula | C18H35NO4Si |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | tert-butyl (2S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxoethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@H]1CC=O |
| InChI | InChI=1S/C18H35NO4Si/c1-17(2,3)22-16(21)19-13-15(10-9-14(19)11-12-20)23-24(7,8)18(4,5)6/h12,14-15H,9-11,13H2,1-8H3/t14-,15-/m0/s1 |
| InChIKey | IXSFFEAJRRQKPJ-GJZGRUSLSA-N |
| XLogP | 4.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|