C21H41NO5Si — CID 77265685
propan-2-yl 7-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxo-1,3-oxazinan-3-yl]heptanoate (PubChem CID 77265685) has the molecular formula C21H41NO5Si and a molecular weight of 415.65 g/mol. Its IUPAC name is propan-2-yl 7-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxo-1,3-oxazinan-3-yl]heptanoate.
| Compound Name | propan-2-yl 7-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxo-1,3-oxazinan-3-yl]heptanoate |
|---|---|
| PubChem CID | 77265685 |
| Molecular Formula | C21H41NO5Si |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | propan-2-yl 7-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxo-1,3-oxazinan-3-yl]heptanoate |
| SMILES | CC(C)OC(=O)CCCCCCN1C(=O)OCCC1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H41NO5Si/c1-17(2)27-19(23)12-10-8-9-11-14-22-18(13-15-25-20(22)24)16-26-28(6,7)21(3,4)5/h17-18H,8-16H2,1-7H3 |
| InChIKey | MGTYIWXGICXZKY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|