C22H40N2O4 — CID 177054270
(2R)-N-[2-[8-(2-formamidoethoxy)oct-4-ynoxy]ethyl]-2,6-dimethylheptanamide (PubChem CID 177054270) has the molecular formula C22H40N2O4 and a molecular weight of 396.57 g/mol. Its IUPAC name is (2R)-N-[2-[8-(2-formamidoethoxy)oct-4-ynoxy]ethyl]-2,6-dimethylheptanamide.
| Compound Name | (2R)-N-[2-[8-(2-formamidoethoxy)oct-4-ynoxy]ethyl]-2,6-dimethylheptanamide |
|---|---|
| PubChem CID | 177054270 |
| Molecular Formula | C22H40N2O4 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | (2R)-N-[2-[8-(2-formamidoethoxy)oct-4-ynoxy]ethyl]-2,6-dimethylheptanamide |
| SMILES | CC(C)CCC[C@@H](C)C(=O)NCCOCCCC#CCCCOCCNC=O |
| InChI | InChI=1S/C22H40N2O4/c1-20(2)11-10-12-21(3)22(26)24-14-18-28-16-9-7-5-4-6-8-15-27-17-13-23-19-25/h19-21H,6-18H2,1-3H3,(H,23,25)(H,24,26)/t21-/m1/s1 |
| InChIKey | FUSLLYIYCOSEKN-OAQYLSRUSA-N |
| XLogP | 2.91 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|