C36H46N6O5 — CID 177055251
tert-butyl N-[4-[4-[[2-[(2S,3aS,7aS)-2-(2-methoxyethylcarbamoyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-6-methylpyrimidin-4-yl]methylcarbamoyl]phenyl]phenyl]carbamate (PubChem CID 177055251) has the molecular formula C36H46N6O5 and a molecular weight of 642.80 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[[2-[(2S,3aS,7aS)-2-(2-methoxyethylcarbamoyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-6-methylpyrimidin-4-yl]methylcarbamoyl]phenyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[[2-[(2S,3aS,7aS)-2-(2-methoxyethylcarbamoyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-6-methylpyrimidin-4-yl]methylcarbamoyl]phenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 177055251 |
| Molecular Formula | C36H46N6O5 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.35 |
| IUPAC Name | tert-butyl N-[4-[4-[[2-[(2S,3aS,7aS)-2-(2-methoxyethylcarbamoyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-6-methylpyrimidin-4-yl]methylcarbamoyl]phenyl]phenyl]carbamate |
| SMILES | COCCNC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1c1nc(C)cc(CNC(=O)c2ccc(-c3ccc(NC(=O)OC(C)(C)C)cc3)cc2)n1 |
| InChI | InChI=1S/C36H46N6O5/c1-23-20-29(40-34(39-23)42-30-9-7-6-8-27(30)21-31(42)33(44)37-18-19-46-5)22-38-32(43)26-12-10-24(11-13-26)25-14-16-28(17-15-25)41-35(45)47-36(2,3)4/h10-17,20,27,30-31H,6-9,18-19,21-22H2,1-5H3,(H,37,44)(H,38,43)(H,41,45)/t27-,30-,31-/m0/s1 |
| InChIKey | BIOAWXVZBKQDQM-NAYUSWPISA-N |
| XLogP | 5.63 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|