C32H39N5O3 — CID 177055456
(2S,3aS,7aS)-1-[6-[[[4-(4-aminophenyl)benzoyl]amino]methyl]-4-methyl-2-pyridinyl]-N-(2-methoxyethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 177055456) has the molecular formula C32H39N5O3 and a molecular weight of 541.70 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-[6-[[[4-(4-aminophenyl)benzoyl]amino]methyl]-4-methyl-2-pyridinyl]-N-(2-methoxyethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aS,7aS)-1-[6-[[[4-(4-aminophenyl)benzoyl]amino]methyl]-4-methyl-2-pyridinyl]-N-(2-methoxyethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 177055456 |
| Molecular Formula | C32H39N5O3 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | (2S,3aS,7aS)-1-[6-[[[4-(4-aminophenyl)benzoyl]amino]methyl]-4-methyl-2-pyridinyl]-N-(2-methoxyethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1c1cc(C)cc(CNC(=O)c2ccc(-c3ccc(N)cc3)cc2)n1 |
| InChI | InChI=1S/C32H39N5O3/c1-21-17-27(20-35-31(38)24-9-7-22(8-10-24)23-11-13-26(33)14-12-23)36-30(18-21)37-28-6-4-3-5-25(28)19-29(37)32(39)34-15-16-40-2/h7-14,17-18,25,28-29H,3-6,15-16,19-20,33H2,1-2H3,(H,34,39)(H,35,38)/t25-,28-,29-/m0/s1 |
| InChIKey | HZQCHKDSEKELJK-FMYROPPKSA-N |
| XLogP | 4.47 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|