C34H45N7O3 — CID 177055459
(2S,3aS,7aS)-1-[2-[3-(2-aminoethoxy)propyl]-6-[1-[[4-(4-aminophenyl)benzoyl]amino]ethyl]pyrimidin-4-yl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 177055459) has the molecular formula C34H45N7O3 and a molecular weight of 599.78 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-[2-[3-(2-aminoethoxy)propyl]-6-[1-[[4-(4-aminophenyl)benzoyl]amino]ethyl]pyrimidin-4-yl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aS,7aS)-1-[2-[3-(2-aminoethoxy)propyl]-6-[1-[[4-(4-aminophenyl)benzoyl]amino]ethyl]pyrimidin-4-yl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 177055459 |
| Molecular Formula | C34H45N7O3 |
| Molecular Weight | 599.78 g/mol |
| Exact Mass | 599.36 |
| IUPAC Name | (2S,3aS,7aS)-1-[2-[3-(2-aminoethoxy)propyl]-6-[1-[[4-(4-aminophenyl)benzoyl]amino]ethyl]pyrimidin-4-yl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1c1cc(C(C)NC(=O)c2ccc(-c3ccc(N)cc3)cc2)nc(CCCOCCN)n1 |
| InChI | InChI=1S/C34H45N7O3/c1-22(38-33(42)25-11-9-23(10-12-25)24-13-15-27(36)16-14-24)28-21-32(40-31(39-28)8-5-18-44-19-17-35)41-29-7-4-3-6-26(29)20-30(41)34(43)37-2/h9-16,21-22,26,29-30H,3-8,17-20,35-36H2,1-2H3,(H,37,43)(H,38,42)/t22?,26-,29-,30-/m0/s1 |
| InChIKey | MRQKIFNDDNACGJ-ARSGDHCCSA-N |
| XLogP | 4.01 |
| TPSA | 148.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.78 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|