C20H20N4O2 — CID 177054304
4-(4-aminophenyl)-N-[(1S)-1-(2-methyl-6-oxo-1H-pyrimidin-4-yl)ethyl]benzamide (PubChem CID 177054304) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 4-(4-aminophenyl)-N-[(1S)-1-(2-methyl-6-oxo-1H-pyrimidin-4-yl)ethyl]benzamide.
| Compound Name | 4-(4-aminophenyl)-N-[(1S)-1-(2-methyl-6-oxo-1H-pyrimidin-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 177054304 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 4-(4-aminophenyl)-N-[(1S)-1-(2-methyl-6-oxo-1H-pyrimidin-4-yl)ethyl]benzamide |
| SMILES | Cc1nc([C@H](C)NC(=O)c2ccc(-c3ccc(N)cc3)cc2)cc(=O)[nH]1 |
| InChI | InChI=1S/C20H20N4O2/c1-12(18-11-19(25)24-13(2)23-18)22-20(26)16-5-3-14(4-6-16)15-7-9-17(21)10-8-15/h3-12H,21H2,1-2H3,(H,22,26)(H,23,24,25)/t12-/m0/s1 |
| InChIKey | VZAOJEMLNZPYGC-LBPRGKRZSA-N |
| XLogP | 2.82 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|