C36H54N4O — CID 177054438
4-(4-aminophenyl)-N-[1-(2,6-dimethylpyrimidin-4-yl)ethyl]benzamide;ethane;1-methyl-2-(2-methylpentyl)cyclohexane (PubChem CID 177054438) has the molecular formula C36H54N4O and a molecular weight of 558.86 g/mol. Its IUPAC name is 4-(4-aminophenyl)-N-[1-(2,6-dimethylpyrimidin-4-yl)ethyl]benzamide;ethane;1-methyl-2-(2-methylpentyl)cyclohexane.
| Compound Name | 4-(4-aminophenyl)-N-[1-(2,6-dimethylpyrimidin-4-yl)ethyl]benzamide;ethane;1-methyl-2-(2-methylpentyl)cyclohexane |
|---|---|
| PubChem CID | 177054438 |
| Molecular Formula | C36H54N4O |
| Molecular Weight | 558.86 g/mol |
| Exact Mass | 558.43 |
| IUPAC Name | 4-(4-aminophenyl)-N-[1-(2,6-dimethylpyrimidin-4-yl)ethyl]benzamide;ethane;1-methyl-2-(2-methylpentyl)cyclohexane |
| SMILES | CC.CCCC(C)CC1CCCCC1C.Cc1cc(C(C)NC(=O)c2ccc(-c3ccc(N)cc3)cc2)nc(C)n1 |
| InChI | InChI=1S/C21H22N4O.C13H26.C2H6/c1-13-12-20(25-15(3)23-13)14(2)24-21(26)18-6-4-16(5-7-18)17-8-10-19(22)11-9-17;1-4-7-11(2)10-13-9-6-5-8-12(13)3;1-2/h4-12,14H,22H2,1-3H3,(H,24,26);11-13H,4-10H2,1-3H3;1-2H3 |
| InChIKey | NDGIDVOGBVTVJX-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.86 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|