C36H49N7O4 — CID 177054714
(2S,3aS,7aS)-1-[2-[3-[2-(2-aminoethoxy)ethoxy]propyl]-6-[1-[[4-(4-aminophenyl)benzoyl]amino]ethyl]pyrimidin-4-yl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 177054714) has the molecular formula C36H49N7O4 and a molecular weight of 643.83 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-[2-[3-[2-(2-aminoethoxy)ethoxy]propyl]-6-[1-[[4-(4-aminophenyl)benzoyl]amino]ethyl]pyrimidin-4-yl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aS,7aS)-1-[2-[3-[2-(2-aminoethoxy)ethoxy]propyl]-6-[1-[[4-(4-aminophenyl)benzoyl]amino]ethyl]pyrimidin-4-yl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 177054714 |
| Molecular Formula | C36H49N7O4 |
| Molecular Weight | 643.83 g/mol |
| Exact Mass | 643.38 |
| IUPAC Name | (2S,3aS,7aS)-1-[2-[3-[2-(2-aminoethoxy)ethoxy]propyl]-6-[1-[[4-(4-aminophenyl)benzoyl]amino]ethyl]pyrimidin-4-yl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1c1cc(C(C)NC(=O)c2ccc(-c3ccc(N)cc3)cc2)nc(CCCOCCOCCN)n1 |
| InChI | InChI=1S/C36H49N7O4/c1-24(40-35(44)27-11-9-25(10-12-27)26-13-15-29(38)16-14-26)30-23-34(42-33(41-30)8-5-18-46-20-21-47-19-17-37)43-31-7-4-3-6-28(31)22-32(43)36(45)39-2/h9-16,23-24,28,31-32H,3-8,17-22,37-38H2,1-2H3,(H,39,45)(H,40,44)/t24?,28-,31-,32-/m0/s1 |
| InChIKey | XCLNICFTEHTMBX-JATMHVTASA-N |
| XLogP | 4.02 |
| TPSA | 157.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.83 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|