C23H39ClN2O6 — CID 177055539
2-[2-[2-[2-[[6-(chloromethyl)-3-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethyl N,N-ditert-butylcarbamate (PubChem CID 177055539) has the molecular formula C23H39ClN2O6 and a molecular weight of 475.03 g/mol. Its IUPAC name is 2-[2-[2-[2-[[6-(chloromethyl)-3-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethyl N,N-ditert-butylcarbamate.
| Compound Name | 2-[2-[2-[2-[[6-(chloromethyl)-3-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethyl N,N-ditert-butylcarbamate |
|---|---|
| PubChem CID | 177055539 |
| Molecular Formula | C23H39ClN2O6 |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 2-[2-[2-[2-[[6-(chloromethyl)-3-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethyl N,N-ditert-butylcarbamate |
| SMILES | CC(C)(C)N(C(=O)OCCOCCOCCOCCOc1ccc(CCl)nc1)C(C)(C)C |
| InChI | InChI=1S/C23H39ClN2O6/c1-22(2,3)26(23(4,5)6)21(27)32-16-14-30-12-10-28-9-11-29-13-15-31-20-8-7-19(17-24)25-18-20/h7-8,18H,9-17H2,1-6H3 |
| InChIKey | ANHAJBQSTRPPOI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 79.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|