C23H33N3O5 — CID 177055938
tert-butyl 4-[2-[[4-[(Z)-1-hydroxy-3-oxopent-1-en-2-yl]phenyl]methylamino]-2-oxoethyl]piperazine-1-carboxylate (PubChem CID 177055938) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is tert-butyl 4-[2-[[4-[(Z)-1-hydroxy-3-oxopent-1-en-2-yl]phenyl]methylamino]-2-oxoethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[4-[(Z)-1-hydroxy-3-oxopent-1-en-2-yl]phenyl]methylamino]-2-oxoethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 177055938 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | tert-butyl 4-[2-[[4-[(Z)-1-hydroxy-3-oxopent-1-en-2-yl]phenyl]methylamino]-2-oxoethyl]piperazine-1-carboxylate |
| SMILES | CCC(=O)/C(=C\O)c1ccc(CNC(=O)CN2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H33N3O5/c1-5-20(28)19(16-27)18-8-6-17(7-9-18)14-24-21(29)15-25-10-12-26(13-11-25)22(30)31-23(2,3)4/h6-9,16,27H,5,10-15H2,1-4H3,(H,24,29)/b19-16- |
| InChIKey | PHHOILONCJKQGH-MNDPQUGUSA-N |
| XLogP | 2.73 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|