C7H9F3N2 — CID 177057511
(E)-1,1,1-trifluoro-N-(propan-2-ylideneamino)but-3-en-2-imine (PubChem CID 177057511) has the molecular formula C7H9F3N2 and a molecular weight of 178.16 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-N-(propan-2-ylideneamino)but-3-en-2-imine.
| Compound Name | (E)-1,1,1-trifluoro-N-(propan-2-ylideneamino)but-3-en-2-imine |
|---|---|
| PubChem CID | 177057511 |
| Molecular Formula | C7H9F3N2 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (E)-1,1,1-trifluoro-N-(propan-2-ylideneamino)but-3-en-2-imine |
| SMILES | C=C/C(=N\N=C(C)C)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N2/c1-4-6(7(8,9)10)12-11-5(2)3/h4H,1H2,2-3H3/b12-6+ |
| InChIKey | INABGUOZOAYGBF-WUXMJOGZSA-N |
| XLogP | 2.57 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|