C12H15F7N2 — CID 159895451
but-3-en-2-imine;bis(1,1-difluoroethene);3,4,4-trifluorobut-3-en-2-imine (PubChem CID 159895451) has the molecular formula C12H15F7N2 and a molecular weight of 320.25 g/mol. Its IUPAC name is but-3-en-2-imine;bis(1,1-difluoroethene);3,4,4-trifluorobut-3-en-2-imine.
| Compound Name | but-3-en-2-imine;bis(1,1-difluoroethene);3,4,4-trifluorobut-3-en-2-imine |
|---|---|
| PubChem CID | 159895451 |
| Molecular Formula | C12H15F7N2 |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | but-3-en-2-imine;bis(1,1-difluoroethene);3,4,4-trifluorobut-3-en-2-imine |
| SMILES | C=C(F)F.C=C(F)F.[H]/N=C(\C)C(F)=C(F)F.[H]/N=C(\C)C=C |
| InChI | InChI=1S/C4H4F3N.C4H7N.2C2H2F2/c1-2(8)3(5)4(6)7;1-3-4(2)5;2*1-2(3)4/h8H,1H3;3,5H,1H2,2H3;2*1H2/b8-2+;5-4+;; |
| InChIKey | NVHAYCJUMFSZOD-IRXYTLPWSA-N |
| XLogP | 6.11 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|