C6H8F3N2+ — CID 163443178
[(Z)-6,6,6-trifluoro-5-iminohex-3-en-2-ylidene]azanium (PubChem CID 163443178) has the molecular formula C6H8F3N2+ and a molecular weight of 165.14 g/mol. Its IUPAC name is [(Z)-6,6,6-trifluoro-5-iminohex-3-en-2-ylidene]azanium.
| Compound Name | [(Z)-6,6,6-trifluoro-5-iminohex-3-en-2-ylidene]azanium |
|---|---|
| PubChem CID | 163443178 |
| Molecular Formula | C6H8F3N2+ |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | [(Z)-6,6,6-trifluoro-5-iminohex-3-en-2-ylidene]azanium |
| SMILES | [H]/N=C(/C=C\C(C)=[NH2+])C(F)(F)F |
| InChI | InChI=1S/C6H7F3N2/c1-4(10)2-3-5(11)6(7,8)9/h2-3,10-11H,1H3/p+1/b3-2-,10-4?,11-5- |
| InChIKey | BAHGTOUPIPHSKA-DBSHIGKKSA-O |
| XLogP | 0.34 |
| TPSA | 49.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|