C6H8FN — CID 123515356
4-fluorohexa-1,4-dien-3-imine (PubChem CID 123515356) has the molecular formula C6H8FN and a molecular weight of 113.13 g/mol. Its IUPAC name is 4-fluorohexa-1,4-dien-3-imine.
| Compound Name | 4-fluorohexa-1,4-dien-3-imine |
|---|---|
| PubChem CID | 123515356 |
| Molecular Formula | C6H8FN |
| Molecular Weight | 113.13 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 4-fluorohexa-1,4-dien-3-imine |
| SMILES | [H]/N=C(\C=C)C(F)=CC |
| InChI | InChI=1S/C6H8FN/c1-3-5(7)6(8)4-2/h3-4,8H,2H2,1H3/b5-3?,8-6+ |
| InChIKey | TVLOAINSTNMIFJ-NIXDYCKDSA-N |
| XLogP | 2.07 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.13 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|