C5H3F6N — CID 134992734
(E)-1,1,1,5,5,5-hexafluoropent-3-en-2-imine (PubChem CID 134992734) has the molecular formula C5H3F6N and a molecular weight of 191.07 g/mol. Its IUPAC name is (E)-1,1,1,5,5,5-hexafluoropent-3-en-2-imine.
| Compound Name | (E)-1,1,1,5,5,5-hexafluoropent-3-en-2-imine |
|---|---|
| PubChem CID | 134992734 |
| Molecular Formula | C5H3F6N |
| Molecular Weight | 191.07 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | (E)-1,1,1,5,5,5-hexafluoropent-3-en-2-imine |
| SMILES | [H]/N=C(\C=C\C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H3F6N/c6-4(7,8)2-1-3(12)5(9,10)11/h1-2,12H/b2-1+,12-3+ |
| InChIKey | PJUHKNKKFTWPAW-GYRQOCMCSA-N |
| XLogP | 2.69 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.07 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|