C7H3F10N — CID 134992781
(E)-1,1,1,2,2,6,6,7,7,7-decafluorohept-4-en-3-imine (PubChem CID 134992781) has the molecular formula C7H3F10N and a molecular weight of 291.09 g/mol. Its IUPAC name is (E)-1,1,1,2,2,6,6,7,7,7-decafluorohept-4-en-3-imine.
| Compound Name | (E)-1,1,1,2,2,6,6,7,7,7-decafluorohept-4-en-3-imine |
|---|---|
| PubChem CID | 134992781 |
| Molecular Formula | C7H3F10N |
| Molecular Weight | 291.09 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | (E)-1,1,1,2,2,6,6,7,7,7-decafluorohept-4-en-3-imine |
| SMILES | [H]/N=C(\C=C\C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H3F10N/c8-4(9,6(12,13)14)2-1-3(18)5(10,11)7(15,16)17/h1-2,18H/b2-1+,18-3+ |
| InChIKey | RTBBKNSAAGUVPG-WWEGOMNESA-N |
| XLogP | 3.96 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.09 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|