C12H22F3N — CID 177057527
ethane;1,1,1-trifluoro-N-(2-methylprop-1-enyl)but-3-en-2-imine (PubChem CID 177057527) has the molecular formula C12H22F3N and a molecular weight of 237.31 g/mol. Its IUPAC name is ethane;1,1,1-trifluoro-N-(2-methylprop-1-enyl)but-3-en-2-imine.
| Compound Name | ethane;1,1,1-trifluoro-N-(2-methylprop-1-enyl)but-3-en-2-imine |
|---|---|
| PubChem CID | 177057527 |
| Molecular Formula | C12H22F3N |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | ethane;1,1,1-trifluoro-N-(2-methylprop-1-enyl)but-3-en-2-imine |
| SMILES | C=C/C(=N\C=C(C)C)C(F)(F)F.CC.CC |
| InChI | InChI=1S/C8H10F3N.2C2H6/c1-4-7(8(9,10)11)12-5-6(2)3;2*1-2/h4-5H,1H2,2-3H3;2*1-2H3/b12-7+;; |
| InChIKey | WGCXLLVAUBKGFT-CURPJKDSSA-N |
| XLogP | 5.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|