About CID 177057594
CID 177057594 (PubChem CID 177057594) has the molecular formula C12H13B3ClF3N2O
and a molecular weight of 326.13 g/mol.
Molecular Properties
| Compound Name | CID 177057594 |
| PubChem CID | 177057594 |
| Molecular Formula | C12H13B3ClF3N2O |
| Molecular Weight | 326.13 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | — |
| SMILES | FC(F)F.[B]C([B])([B])c1nc(Cl)cc(OC2CCCCC2)n1 |
| InChI | InChI=1S/C11H12B3ClN2O.CHF3/c12-11(13,14)10-16-8(15)6-9(17-10)18-7-4-2-1-3-5-7;2-1(3)4/h6-7H,1-5H2;1H |
| InChIKey | YEQNACZPDIRTSO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.13 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177057594 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177057594?
The IUPAC name of CID 177057594 (CID 177057594) is not available.
What is the SMILES notation for CID 177057594?
The canonical SMILES for CID 177057594 is FC(F)F.[B]C([B])([B])c1nc(Cl)cc(OC2CCCCC2)n1.
What is the InChIKey of CID 177057594?
The InChIKey is YEQNACZPDIRTSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12B3ClN2O.CHF3/c12-11(13,14)10-16-8(15)6-9(17-10)18-7-4-2-1-3-5-7;2-1(3)4/h6-7H,1-5H2;1H.
What are the key properties of CID 177057594?
CID 177057594 has a molecular weight of 326.13 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177057594 is sourced from PubChem (CID 177057594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).