About tert-butyl acetate;4-methyl-2-[(1-methylcyclobutyl)methyl]hexanoic acid
tert-butyl acetate;4-methyl-2-[(1-methylcyclobutyl)methyl]hexanoic acid (PubChem CID 177059780) has the molecular formula C19H36O4
and a molecular weight of 328.49 g/mol. Its IUPAC name is tert-butyl acetate;4-methyl-2-[(1-methylcyclobutyl)methyl]hexanoic acid.
Molecular Properties
| Compound Name | tert-butyl acetate;4-methyl-2-[(1-methylcyclobutyl)methyl]hexanoic acid |
| PubChem CID | 177059780 |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | tert-butyl acetate;4-methyl-2-[(1-methylcyclobutyl)methyl]hexanoic acid |
| SMILES | CC(=O)OC(C)(C)C.CCC(C)CC(CC1(C)CCC1)C(=O)O |
| InChI | InChI=1S/C13H24O2.C6H12O2/c1-4-10(2)8-11(12(14)15)9-13(3)6-5-7-13;1-5(7)8-6(2,3)4/h10-11H,4-9H2,1-3H3,(H,14,15);1-4H3 |
| InChIKey | PRNBOHYGLADJKR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl acetate;4-methyl-2-[(1-methylcyclobutyl)methyl]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl acetate;4-methyl-2-[(1-methylcyclobutyl)methyl]hexanoic acid?
The IUPAC name of tert-butyl acetate;4-methyl-2-[(1-methylcyclobutyl)methyl]hexanoic acid (CID 177059780) is tert-butyl acetate;4-methyl-2-[(1-methylcyclobutyl)methyl]hexanoic acid.
What is the SMILES notation for tert-butyl acetate;4-methyl-2-[(1-methylcyclobutyl)methyl]hexanoic acid?
The canonical SMILES for tert-butyl acetate;4-methyl-2-[(1-methylcyclobutyl)methyl]hexanoic acid is CC(=O)OC(C)(C)C.CCC(C)CC(CC1(C)CCC1)C(=O)O.
What is the InChIKey of tert-butyl acetate;4-methyl-2-[(1-methylcyclobutyl)methyl]hexanoic acid?
The InChIKey is PRNBOHYGLADJKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2.C6H12O2/c1-4-10(2)8-11(12(14)15)9-13(3)6-5-7-13;1-5(7)8-6(2,3)4/h10-11H,4-9H2,1-3H3,(H,14,15);1-4H3.
What are the key properties of tert-butyl acetate;4-methyl-2-[(1-methylcyclobutyl)methyl]hexanoic acid?
tert-butyl acetate;4-methyl-2-[(1-methylcyclobutyl)methyl]hexanoic acid has a molecular weight of 328.49 g/mol, XLogP of 5.05, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl acetate;4-methyl-2-[(1-methylcyclobutyl)methyl]hexanoic acid is sourced from PubChem (CID 177059780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).