C20H15ClF3N3O4 — CID 177060684
3-[4-[3-[2-chloro-4-(trifluoromethoxy)anilino]-2-oxopyrazin-1-yl]phenyl]propanoic acid (PubChem CID 177060684) has the molecular formula C20H15ClF3N3O4 and a molecular weight of 453.80 g/mol. Its IUPAC name is 3-[4-[3-[2-chloro-4-(trifluoromethoxy)anilino]-2-oxopyrazin-1-yl]phenyl]propanoic acid.
| Compound Name | 3-[4-[3-[2-chloro-4-(trifluoromethoxy)anilino]-2-oxopyrazin-1-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 177060684 |
| Molecular Formula | C20H15ClF3N3O4 |
| Molecular Weight | 453.80 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 3-[4-[3-[2-chloro-4-(trifluoromethoxy)anilino]-2-oxopyrazin-1-yl]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(-n2ccnc(Nc3ccc(OC(F)(F)F)cc3Cl)c2=O)cc1 |
| InChI | InChI=1S/C20H15ClF3N3O4/c21-15-11-14(31-20(22,23)24)6-7-16(15)26-18-19(30)27(10-9-25-18)13-4-1-12(2-5-13)3-8-17(28)29/h1-2,4-7,9-11H,3,8H2,(H,25,26)(H,28,29) |
| InChIKey | RNZGONNBFTZNIT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.80 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |