About 3-[4-(trifluoromethoxy)phenyl]propanenitrile;3-[4-(trifluoromethoxy)phenyl]propanoic acid
3-[4-(trifluoromethoxy)phenyl]propanenitrile;3-[4-(trifluoromethoxy)phenyl]propanoic acid (PubChem CID 162216346) has the molecular formula C20H17F6NO4
and a molecular weight of 449.35 g/mol. Its IUPAC name is 3-[4-(trifluoromethoxy)phenyl]propanenitrile;3-[4-(trifluoromethoxy)phenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-(trifluoromethoxy)phenyl]propanenitrile;3-[4-(trifluoromethoxy)phenyl]propanoic acid |
| PubChem CID | 162216346 |
| Molecular Formula | C20H17F6NO4 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 3-[4-(trifluoromethoxy)phenyl]propanenitrile;3-[4-(trifluoromethoxy)phenyl]propanoic acid |
| SMILES | N#CCCc1ccc(OC(F)(F)F)cc1.O=C(O)CCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H8F3NO.C10H9F3O3/c11-10(12,13)15-9-5-3-8(4-6-9)2-1-7-14;11-10(12,13)16-8-4-1-7(2-5-8)3-6-9(14)15/h3-6H,1-2H2;1-2,4-5H,3,6H2,(H,14,15) |
| InChIKey | ZTNAHSPKVKVRKZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(trifluoromethoxy)phenyl]propanenitrile;3-[4-(trifluoromethoxy)phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(trifluoromethoxy)phenyl]propanenitrile;3-[4-(trifluoromethoxy)phenyl]propanoic acid?
The IUPAC name of 3-[4-(trifluoromethoxy)phenyl]propanenitrile;3-[4-(trifluoromethoxy)phenyl]propanoic acid (CID 162216346) is 3-[4-(trifluoromethoxy)phenyl]propanenitrile;3-[4-(trifluoromethoxy)phenyl]propanoic acid.
What is the SMILES notation for 3-[4-(trifluoromethoxy)phenyl]propanenitrile;3-[4-(trifluoromethoxy)phenyl]propanoic acid?
The canonical SMILES for 3-[4-(trifluoromethoxy)phenyl]propanenitrile;3-[4-(trifluoromethoxy)phenyl]propanoic acid is N#CCCc1ccc(OC(F)(F)F)cc1.O=C(O)CCc1ccc(OC(F)(F)F)cc1.
What is the InChIKey of 3-[4-(trifluoromethoxy)phenyl]propanenitrile;3-[4-(trifluoromethoxy)phenyl]propanoic acid?
The InChIKey is ZTNAHSPKVKVRKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3NO.C10H9F3O3/c11-10(12,13)15-9-5-3-8(4-6-9)2-1-7-14;11-10(12,13)16-8-4-1-7(2-5-8)3-6-9(14)15/h3-6H,1-2H2;1-2,4-5H,3,6H2,(H,14,15).
What are the key properties of 3-[4-(trifluoromethoxy)phenyl]propanenitrile;3-[4-(trifluoromethoxy)phenyl]propanoic acid?
3-[4-(trifluoromethoxy)phenyl]propanenitrile;3-[4-(trifluoromethoxy)phenyl]propanoic acid has a molecular weight of 449.35 g/mol, XLogP of 5.64, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(trifluoromethoxy)phenyl]propanenitrile;3-[4-(trifluoromethoxy)phenyl]propanoic acid is sourced from PubChem (CID 162216346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).