C13H10F3NO3 — CID 134621485
(E)-3-[3-(2-cyanoethyl)-5-(trifluoromethoxy)phenyl]prop-2-enoic acid (PubChem CID 134621485) has the molecular formula C13H10F3NO3 and a molecular weight of 285.22 g/mol. Its IUPAC name is (E)-3-[3-(2-cyanoethyl)-5-(trifluoromethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(2-cyanoethyl)-5-(trifluoromethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134621485 |
| Molecular Formula | C13H10F3NO3 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (E)-3-[3-(2-cyanoethyl)-5-(trifluoromethoxy)phenyl]prop-2-enoic acid |
| SMILES | N#CCCc1cc(/C=C/C(=O)O)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H10F3NO3/c14-13(15,16)20-11-7-9(2-1-5-17)6-10(8-11)3-4-12(18)19/h3-4,6-8H,1-2H2,(H,18,19)/b4-3+ |
| InChIKey | GBYPJRNZVLTLHO-ONEGZZNKSA-N |
| XLogP | 3.14 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|