About 3,3-dimethylpentan-1-ol;ethane;3-methyl-N-propan-2-ylbutan-1-amine
3,3-dimethylpentan-1-ol;ethane;3-methyl-N-propan-2-ylbutan-1-amine (PubChem CID 177062263) has the molecular formula C17H41NO
and a molecular weight of 275.52 g/mol. Its IUPAC name is 3,3-dimethylpentan-1-ol;ethane;3-methyl-N-propan-2-ylbutan-1-amine.
Molecular Properties
| Compound Name | 3,3-dimethylpentan-1-ol;ethane;3-methyl-N-propan-2-ylbutan-1-amine |
| PubChem CID | 177062263 |
| Molecular Formula | C17H41NO |
| Molecular Weight | 275.52 g/mol |
| Exact Mass | 275.32 |
| IUPAC Name | 3,3-dimethylpentan-1-ol;ethane;3-methyl-N-propan-2-ylbutan-1-amine |
| SMILES | CC.CC(C)CCNC(C)C.CCC(C)(C)CCO |
| InChI | InChI=1S/C8H19N.C7H16O.C2H6/c1-7(2)5-6-9-8(3)4;1-4-7(2,3)5-6-8;1-2/h7-9H,5-6H2,1-4H3;8H,4-6H2,1-3H3;1-2H3 |
| InChIKey | UNGWPVBNUBKZAH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-dimethylpentan-1-ol;ethane;3-methyl-N-propan-2-ylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylpentan-1-ol;ethane;3-methyl-N-propan-2-ylbutan-1-amine?
The IUPAC name of 3,3-dimethylpentan-1-ol;ethane;3-methyl-N-propan-2-ylbutan-1-amine (CID 177062263) is 3,3-dimethylpentan-1-ol;ethane;3-methyl-N-propan-2-ylbutan-1-amine.
What is the SMILES notation for 3,3-dimethylpentan-1-ol;ethane;3-methyl-N-propan-2-ylbutan-1-amine?
The canonical SMILES for 3,3-dimethylpentan-1-ol;ethane;3-methyl-N-propan-2-ylbutan-1-amine is CC.CC(C)CCNC(C)C.CCC(C)(C)CCO.
What is the InChIKey of 3,3-dimethylpentan-1-ol;ethane;3-methyl-N-propan-2-ylbutan-1-amine?
The InChIKey is UNGWPVBNUBKZAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C7H16O.C2H6/c1-7(2)5-6-9-8(3)4;1-4-7(2,3)5-6-8;1-2/h7-9H,5-6H2,1-4H3;8H,4-6H2,1-3H3;1-2H3.
What are the key properties of 3,3-dimethylpentan-1-ol;ethane;3-methyl-N-propan-2-ylbutan-1-amine?
3,3-dimethylpentan-1-ol;ethane;3-methyl-N-propan-2-ylbutan-1-amine has a molecular weight of 275.52 g/mol, XLogP of 4.86, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylpentan-1-ol;ethane;3-methyl-N-propan-2-ylbutan-1-amine is sourced from PubChem (CID 177062263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).