C19H42N2 — CID 171106690
2-methyl-N-(3-methylbut-1-en-2-yl)pentan-2-amine;3-methyl-N-propan-2-ylbutan-1-amine (PubChem CID 171106690) has the molecular formula C19H42N2 and a molecular weight of 298.56 g/mol. Its IUPAC name is 2-methyl-N-(3-methylbut-1-en-2-yl)pentan-2-amine;3-methyl-N-propan-2-ylbutan-1-amine.
| Compound Name | 2-methyl-N-(3-methylbut-1-en-2-yl)pentan-2-amine;3-methyl-N-propan-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 171106690 |
| Molecular Formula | C19H42N2 |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.33 |
| IUPAC Name | 2-methyl-N-(3-methylbut-1-en-2-yl)pentan-2-amine;3-methyl-N-propan-2-ylbutan-1-amine |
| SMILES | C=C(NC(C)(C)CCC)C(C)C.CC(C)CCNC(C)C |
| InChI | InChI=1S/C11H23N.C8H19N/c1-7-8-11(5,6)12-10(4)9(2)3;1-7(2)5-6-9-8(3)4/h9,12H,4,7-8H2,1-3,5-6H3;7-9H,5-6H2,1-4H3 |
| InChIKey | PLFOVSHTZOAHRJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |