C11H27N3 — CID 177062489
ethane;(Z)-(4-methyliminopiperidin-3-ylidene)methanamine;molecular hydrogen (PubChem CID 177062489) has the molecular formula C11H27N3 and a molecular weight of 201.36 g/mol. Its IUPAC name is ethane;(Z)-(4-methyliminopiperidin-3-ylidene)methanamine;molecular hydrogen.
| Compound Name | ethane;(Z)-(4-methyliminopiperidin-3-ylidene)methanamine;molecular hydrogen |
|---|---|
| PubChem CID | 177062489 |
| Molecular Formula | C11H27N3 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.22 |
| IUPAC Name | ethane;(Z)-(4-methyliminopiperidin-3-ylidene)methanamine;molecular hydrogen |
| SMILES | C/N=C1\CCNC\C1=C\N.CC.CC.[H][H] |
| InChI | InChI=1S/C7H13N3.2C2H6.H2/c1-9-7-2-3-10-5-6(7)4-8;2*1-2;/h4,10H,2-3,5,8H2,1H3;2*1-2H3;1H/b6-4-,9-7+;;; |
| InChIKey | HUCVXNAFNUFYNR-XPSXWSNBSA-N |
| XLogP | 2.19 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|