C20H26ClNO2 — CID 177062759
N-[(3-chloro-5-methylphenyl)methyl]-3,4-bis(1-methoxyethenyl)cyclohex-3-en-1-amine (PubChem CID 177062759) has the molecular formula C20H26ClNO2 and a molecular weight of 347.89 g/mol. Its IUPAC name is N-[(3-chloro-5-methylphenyl)methyl]-3,4-bis(1-methoxyethenyl)cyclohex-3-en-1-amine.
| Compound Name | N-[(3-chloro-5-methylphenyl)methyl]-3,4-bis(1-methoxyethenyl)cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 177062759 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-[(3-chloro-5-methylphenyl)methyl]-3,4-bis(1-methoxyethenyl)cyclohex-3-en-1-amine |
| SMILES | C=C(OC)C1=C(C(=C)OC)CC(NCc2cc(C)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H26ClNO2/c1-13-8-16(10-17(21)9-13)12-22-18-6-7-19(14(2)23-4)20(11-18)15(3)24-5/h8-10,18,22H,2-3,6-7,11-12H2,1,4-5H3 |
| InChIKey | OZOOYAXRHNGLCQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|