C14H18ClNO — CID 66896178
N-[[3-chloro-5-(3-methoxyprop-1-enyl)phenyl]methyl]cyclopropanamine (PubChem CID 66896178) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is N-[[3-chloro-5-(3-methoxyprop-1-enyl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-chloro-5-(3-methoxyprop-1-enyl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 66896178 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | N-[[3-chloro-5-(3-methoxyprop-1-enyl)phenyl]methyl]cyclopropanamine |
| SMILES | COCC=Cc1cc(Cl)cc(CNC2CC2)c1 |
| InChI | InChI=1S/C14H18ClNO/c1-17-6-2-3-11-7-12(9-13(15)8-11)10-16-14-4-5-14/h2-3,7-9,14,16H,4-6,10H2,1H3 |
| InChIKey | BRMIMMQPJVJVOL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |