C14H17Cl2NO2 — CID 60878743
N-[[3-chloro-4-[(E)-3-chloroprop-2-enoxy]-5-methoxyphenyl]methyl]cyclopropanamine (PubChem CID 60878743) has the molecular formula C14H17Cl2NO2 and a molecular weight of 302.20 g/mol. Its IUPAC name is N-[[3-chloro-4-[(E)-3-chloroprop-2-enoxy]-5-methoxyphenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-chloro-4-[(E)-3-chloroprop-2-enoxy]-5-methoxyphenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 60878743 |
| Molecular Formula | C14H17Cl2NO2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | N-[[3-chloro-4-[(E)-3-chloroprop-2-enoxy]-5-methoxyphenyl]methyl]cyclopropanamine |
| SMILES | COc1cc(CNC2CC2)cc(Cl)c1OC/C=C/Cl |
| InChI | InChI=1S/C14H17Cl2NO2/c1-18-13-8-10(9-17-11-3-4-11)7-12(16)14(13)19-6-2-5-15/h2,5,7-8,11,17H,3-4,6,9H2,1H3/b5-2+ |
| InChIKey | JMJPRJPTHIIAIB-GORDUTHDSA-N |
| XLogP | 3.73 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |