About CID 177063294
CID 177063294 (PubChem CID 177063294) has the molecular formula C43H22B10N2
and a molecular weight of 674.78 g/mol.
Molecular Properties
| Compound Name | CID 177063294 |
| PubChem CID | 177063294 |
| Molecular Formula | C43H22B10N2 |
| Molecular Weight | 674.78 g/mol |
| Exact Mass | 676.27 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c2c(c1[B])c1c3c4c([B])c([B])c([B])c([B])c4n(-c4ccc(-c5ccccc5)cc4)c3c([B])c([B])c1n2C(/C=C(\C=C)c1ccccc1)=C/C |
| InChI | InChI=1S/C43H22B10N2/c1-3-20(21-11-7-5-8-12-21)19-24(4-2)54-40-26(28-30(44)32(46)34(48)36(50)42(28)54)27-29-31(45)33(47)35(49)37(51)43(29)55(41(27)39(53)38(40)52)25-17-15-23(16-18-25)22-13-9-6-10-14-22/h3-19H,1H2,2H3/b20-19+,24-4+ |
| InChIKey | MDRSSNZCPFDSTO-BBTAZAQRSA-N |
| XLogP | -0.37 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 674.78 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 177063294 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177063294?
The IUPAC name of CID 177063294 (CID 177063294) is not available.
What is the SMILES notation for CID 177063294?
The canonical SMILES for CID 177063294 is [B]c1c([B])c([B])c2c(c1[B])c1c3c4c([B])c([B])c([B])c([B])c4n(-c4ccc(-c5ccccc5)cc4)c3c([B])c([B])c1n2C(/C=C(\C=C)c1ccccc1)=C/C.
What is the InChIKey of CID 177063294?
The InChIKey is MDRSSNZCPFDSTO-BBTAZAQRSA-N. The full InChI is InChI=1S/C43H22B10N2/c1-3-20(21-11-7-5-8-12-21)19-24(4-2)54-40-26(28-30(44)32(46)34(48)36(50)42(28)54)27-29-31(45)33(47)35(49)37(51)43(29)55(41(27)39(53)38(40)52)25-17-15-23(16-18-25)22-13-9-6-10-14-22/h3-19H,1H2,2H3/b20-19+,24-4+.
What are the key properties of CID 177063294?
CID 177063294 has a molecular weight of 674.78 g/mol, XLogP of -0.37, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177063294 is sourced from PubChem (CID 177063294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).