C24H23ClF2N2O5 — CID 177063952
4-[4-[(1S)-1-[(4-chloro-5,6-difluoro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]oxane-4-carboxylic acid (PubChem CID 177063952) has the molecular formula C24H23ClF2N2O5 and a molecular weight of 492.91 g/mol. Its IUPAC name is 4-[4-[(1S)-1-[(4-chloro-5,6-difluoro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]oxane-4-carboxylic acid.
| Compound Name | 4-[4-[(1S)-1-[(4-chloro-5,6-difluoro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 177063952 |
| Molecular Formula | C24H23ClF2N2O5 |
| Molecular Weight | 492.91 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 4-[4-[(1S)-1-[(4-chloro-5,6-difluoro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]oxane-4-carboxylic acid |
| SMILES | Cn1c(C(=O)N[C@H](CO)c2ccc(C3(C(=O)O)CCOCC3)cc2)cc2c(Cl)c(F)c(F)cc21 |
| InChI | InChI=1S/C24H23ClF2N2O5/c1-29-18-11-16(26)21(27)20(25)15(18)10-19(29)22(31)28-17(12-30)13-2-4-14(5-3-13)24(23(32)33)6-8-34-9-7-24/h2-5,10-11,17,30H,6-9,12H2,1H3,(H,28,31)(H,32,33)/t17-/m1/s1 |
| InChIKey | YUBHAUUUGBBYOT-QGZVFWFLSA-N |
| XLogP | 3.71 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.91 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|