C23H36O4 — CID 177067672
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-6-(methoxymethoxy)-5-pentylcyclohexa-2,4-dien-1-one (PubChem CID 177067672) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-6-(methoxymethoxy)-5-pentylcyclohexa-2,4-dien-1-one.
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-6-(methoxymethoxy)-5-pentylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 177067672 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-6-(methoxymethoxy)-5-pentylcyclohexa-2,4-dien-1-one |
| SMILES | CCCCCC1=CC(O)=C(C/C=C(\C)CCC=C(C)C)C(=O)C1OCOC |
| InChI | InChI=1S/C23H36O4/c1-6-7-8-12-19-15-21(24)20(22(25)23(19)27-16-26-5)14-13-18(4)11-9-10-17(2)3/h10,13,15,23-24H,6-9,11-12,14,16H2,1-5H3/b18-13+ |
| InChIKey | LQYJUCNQGLQGSI-QGOAFFKASA-N |
| XLogP | 5.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|