About 8-(4-nitrophenoxy)octyl methanesulfonate
8-(4-nitrophenoxy)octyl methanesulfonate (PubChem CID 177068019) has the molecular formula C15H23NO6S
and a molecular weight of 345.42 g/mol. Its IUPAC name is 8-(4-nitrophenoxy)octyl methanesulfonate.
Molecular Properties
| Compound Name | 8-(4-nitrophenoxy)octyl methanesulfonate |
| PubChem CID | 177068019 |
| Molecular Formula | C15H23NO6S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 8-(4-nitrophenoxy)octyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCCCCCCOc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H23NO6S/c1-23(19,20)22-13-7-5-3-2-4-6-12-21-15-10-8-14(9-11-15)16(17)18/h8-11H,2-7,12-13H2,1H3 |
| InChIKey | CHXDGSSBBIEBBO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 8-(4-nitrophenoxy)octyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-nitrophenoxy)octyl methanesulfonate?
The IUPAC name of 8-(4-nitrophenoxy)octyl methanesulfonate (CID 177068019) is 8-(4-nitrophenoxy)octyl methanesulfonate.
What is the SMILES notation for 8-(4-nitrophenoxy)octyl methanesulfonate?
The canonical SMILES for 8-(4-nitrophenoxy)octyl methanesulfonate is CS(=O)(=O)OCCCCCCCCOc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 8-(4-nitrophenoxy)octyl methanesulfonate?
The InChIKey is CHXDGSSBBIEBBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO6S/c1-23(19,20)22-13-7-5-3-2-4-6-12-21-15-10-8-14(9-11-15)16(17)18/h8-11H,2-7,12-13H2,1H3.
What are the key properties of 8-(4-nitrophenoxy)octyl methanesulfonate?
8-(4-nitrophenoxy)octyl methanesulfonate has a molecular weight of 345.42 g/mol, XLogP of 3.29, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-nitrophenoxy)octyl methanesulfonate is sourced from PubChem (CID 177068019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).