C23H29N5O2S — CID 177070428
3-(4-butoxy-3-methyl-1-pent-3-ynylpyrazol-5-yl)-4-[(4-methoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 177070428) has the molecular formula C23H29N5O2S and a molecular weight of 439.59 g/mol. Its IUPAC name is 3-(4-butoxy-3-methyl-1-pent-3-ynylpyrazol-5-yl)-4-[(4-methoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-butoxy-3-methyl-1-pent-3-ynylpyrazol-5-yl)-4-[(4-methoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 177070428 |
| Molecular Formula | C23H29N5O2S |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 3-(4-butoxy-3-methyl-1-pent-3-ynylpyrazol-5-yl)-4-[(4-methoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CC#CCCn1nc(C)c(OCCCC)c1-c1n[nH]c(=S)n1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H29N5O2S/c1-5-7-9-14-28-20(21(17(3)26-28)30-15-8-6-2)22-24-25-23(31)27(22)16-18-10-12-19(29-4)13-11-18/h10-13H,6,8-9,14-16H2,1-4H3,(H,25,31) |
| InChIKey | CHYJRQBTNQTNFJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|