C21H27N3O2S — CID 143589688
ethane;3-(2-hydroxy-5-propan-2-ylphenyl)-4-[(4-methoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 143589688) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is ethane;3-(2-hydroxy-5-propan-2-ylphenyl)-4-[(4-methoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | ethane;3-(2-hydroxy-5-propan-2-ylphenyl)-4-[(4-methoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 143589688 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | ethane;3-(2-hydroxy-5-propan-2-ylphenyl)-4-[(4-methoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CC.COc1ccc(Cn2c(-c3cc(C(C)C)ccc3O)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C19H21N3O2S.C2H6/c1-12(2)14-6-9-17(23)16(10-14)18-20-21-19(25)22(18)11-13-4-7-15(24-3)8-5-13;1-2/h4-10,12,23H,11H2,1-3H3,(H,21,25);1-2H3 |
| InChIKey | UIHYMPVOBIPDEY-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|