C21H25N3O4S — CID 140521375
3-(2-hydroxy-5-propan-2-ylphenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 140521375) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is 3-(2-hydroxy-5-propan-2-ylphenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2-hydroxy-5-propan-2-ylphenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 140521375 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 3-(2-hydroxy-5-propan-2-ylphenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc(Cn2c(-c3cc(C(C)C)ccc3O)n[nH]c2=S)cc(OC)c1OC |
| InChI | InChI=1S/C21H25N3O4S/c1-12(2)14-6-7-16(25)15(10-14)20-22-23-21(29)24(20)11-13-8-17(26-3)19(28-5)18(9-13)27-4/h6-10,12,25H,11H2,1-5H3,(H,23,29) |
| InChIKey | AOLODGOVWYLKIG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 81.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|