C15H20N4O2S — CID 99812483
2-hydroxy-N-[2-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-5-propan-2-ylbenzamide (PubChem CID 99812483) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is 2-hydroxy-N-[2-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-5-propan-2-ylbenzamide.
| Compound Name | 2-hydroxy-N-[2-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-5-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 99812483 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-hydroxy-N-[2-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-5-propan-2-ylbenzamide |
| SMILES | Cc1n[nH]c(=S)n1CCNC(=O)c1cc(C(C)C)ccc1O |
| InChI | InChI=1S/C15H20N4O2S/c1-9(2)11-4-5-13(20)12(8-11)14(21)16-6-7-19-10(3)17-18-15(19)22/h4-5,8-9,20H,6-7H2,1-3H3,(H,16,21)(H,18,22) |
| InChIKey | RXQYSMXGUWOXBV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|